C11H12N4O4 — CID 135405747
9-[(1R,4S,5S)-4,5-dihydroxy-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one (PubChem CID 135405747) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 9-[(1R,4S,5S)-4,5-dihydroxy-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one.
| Compound Name | 9-[(1R,4S,5S)-4,5-dihydroxy-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135405747 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 9-[(1R,4S,5S)-4,5-dihydroxy-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1C=C[C@](O)(CO)[C@H]1O |
| InChI | InChI=1S/C11H12N4O4/c16-3-11(19)2-1-6(8(11)17)15-5-14-7-9(15)12-4-13-10(7)18/h1-2,4-6,8,16-17,19H,3H2,(H,12,13,18)/t6-,8+,11+/m1/s1 |
| InChIKey | FVAVBVBTZQBYBJ-ZYAQMDEOSA-N |
| XLogP | -1.69 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|