C12H14N4O4 — CID 136797911
9-[(1S,4R,5S)-4,5-dihydroxy-3-[(1S)-1-hydroxyethyl]cyclopent-2-en-1-yl]-1H-purin-6-one (PubChem CID 136797911) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 9-[(1S,4R,5S)-4,5-dihydroxy-3-[(1S)-1-hydroxyethyl]cyclopent-2-en-1-yl]-1H-purin-6-one.
| Compound Name | 9-[(1S,4R,5S)-4,5-dihydroxy-3-[(1S)-1-hydroxyethyl]cyclopent-2-en-1-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136797911 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 9-[(1S,4R,5S)-4,5-dihydroxy-3-[(1S)-1-hydroxyethyl]cyclopent-2-en-1-yl]-1H-purin-6-one |
| SMILES | C[C@H](O)C1=C[C@H](n2cnc3c(=O)[nH]cnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14N4O4/c1-5(17)6-2-7(10(19)9(6)18)16-4-15-8-11(16)13-3-14-12(8)20/h2-5,7,9-10,17-19H,1H3,(H,13,14,20)/t5-,7-,9+,10-/m0/s1 |
| InChIKey | ICDVNRWDCAPZNL-ZAQCRPJCSA-N |
| XLogP | -1.30 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|