C10H14N4O5 — CID 139665696
9-(2,3,4-trihydroxycyclopentyl)-1H-purin-6-one;hydrate (PubChem CID 139665696) has the molecular formula C10H14N4O5 and a molecular weight of 270.25 g/mol. Its IUPAC name is 9-(2,3,4-trihydroxycyclopentyl)-1H-purin-6-one;hydrate.
| Compound Name | 9-(2,3,4-trihydroxycyclopentyl)-1H-purin-6-one;hydrate |
|---|---|
| PubChem CID | 139665696 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 9-(2,3,4-trihydroxycyclopentyl)-1H-purin-6-one;hydrate |
| SMILES | O.O=c1[nH]cnc2c1ncn2C1CC(O)C(O)C1O |
| InChI | InChI=1S/C10H12N4O4.H2O/c15-5-1-4(7(16)8(5)17)14-3-13-6-9(14)11-2-12-10(6)18;/h2-5,7-8,15-17H,1H2,(H,11,12,18);1H2 |
| InChIKey | ILCUWKABJGPMFT-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |