C10H12N4O4 — CID 135489906
9-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1H-purin-6-one (PubChem CID 135489906) has the molecular formula C10H12N4O4 and a molecular weight of 252.23 g/mol. Its IUPAC name is 9-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1H-purin-6-one.
| Compound Name | 9-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135489906 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 9-[(3S,4R,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1CO[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C10H12N4O4/c15-1-6-8(16)5(2-18-6)14-4-13-7-9(14)11-3-12-10(7)17/h3-6,8,15-16H,1-2H2,(H,11,12,17)/t5-,6-,8+/m0/s1 |
| InChIKey | VUDZUOKPXFETKY-VMHSAVOQSA-N |
| XLogP | -1.59 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |