C13H11F3N4O4 — CID 135912012
9-[(2R,3S,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135912012) has the molecular formula C13H11F3N4O4 and a molecular weight of 344.25 g/mol. Its IUPAC name is 9-[(2R,3S,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135912012 |
| Molecular Formula | C13H11F3N4O4 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 9-[(2R,3S,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@@H](C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C13H11F3N4O4/c1-2-12(3-21)8(22)6(13(14,15)16)11(24-12)20-5-19-7-9(20)17-4-18-10(7)23/h1,4-6,8,11,21-22H,3H2,(H,17,18,23)/t6-,8-,11+,12+/m0/s1 |
| InChIKey | AOUNDFUZJPFMEQ-IVOXQJEKSA-N |
| XLogP | -0.45 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|