C11H13N7O4 — CID 135911972
9-[(2R,3S,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one (PubChem CID 135911972) has the molecular formula C11H13N7O4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 9-[(2R,3S,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3S,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135911972 |
| Molecular Formula | C11H13N7O4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 9-[(2R,3S,4S,5R)-5-azido-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-1H-purin-6-one |
| SMILES | C[C@@H]1[C@H](n2cnc3c(=O)[nH]cnc32)O[C@@](CO)(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C11H13N7O4/c1-5-7(20)11(2-19,16-17-12)22-10(5)18-4-15-6-8(18)13-3-14-9(6)21/h3-5,7,10,19-20H,2H2,1H3,(H,13,14,21)/t5-,7-,10+,11+/m0/s1 |
| InChIKey | YBMQTUTWVZCTOY-ICERDWBASA-N |
| XLogP | -0.36 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|