C12H16N7O3+ — CID 158228192
[(2R,3S,4S,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-2-yl]imino-iminoazanium (PubChem CID 158228192) has the molecular formula C12H16N7O3+ and a molecular weight of 306.31 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-2-yl]imino-iminoazanium.
| Compound Name | [(2R,3S,4S,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-2-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 158228192 |
| Molecular Formula | C12H16N7O3+ |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(7-aminoimidazo[4,5-b]pyridin-3-yl)-3-hydroxy-2-(hydroxymethyl)-4-methyloxolan-2-yl]imino-iminoazanium |
| SMILES | C[C@@H]1[C@H](n2cnc3c(N)ccnc32)O[C@@](CO)(N=[N+]=N)[C@H]1O |
| InChI | InChI=1S/C12H16N7O3/c1-6-9(21)12(4-20,17-18-14)22-11(6)19-5-16-8-7(13)2-3-15-10(8)19/h2-3,5-6,9,11,14,20-21H,4H2,1H3,(H2,13,15)/q+1/t6-,9-,11+,12+/m0/s1 |
| InChIKey | SWUICJHNNHNNGV-KIUQNAOPSA-N |
| XLogP | -0.22 |
| TPSA | 156.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|