C11H12F3N8O4+ — CID 147852149
[(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-(trifluoromethyl)oxolan-2-yl]imino-iminoazanium (PubChem CID 147852149) has the molecular formula C11H12F3N8O4+ and a molecular weight of 377.26 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-(trifluoromethyl)oxolan-2-yl]imino-iminoazanium.
| Compound Name | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-(trifluoromethyl)oxolan-2-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 147852149 |
| Molecular Formula | C11H12F3N8O4+ |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-(trifluoromethyl)oxolan-2-yl]imino-iminoazanium |
| SMILES | N=[N+]=N[C@]1(CO)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@@H](C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C11H11F3N8O4/c12-11(13,14)3-5(24)10(1-23,20-21-16)26-8(3)22-2-17-4-6(22)18-9(15)19-7(4)25/h2-3,5,8,16,23-24H,1H2,(H2-,15,18,19,25)/p+1/t3-,5-,8+,10+/m0/s1 |
| InChIKey | HVAGZPORLWXCMY-MNNBBBMKSA-O |
| XLogP | -0.99 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|