C10H10F2N8O4 — CID 171931093
2-amino-9-[(2R,4R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 171931093) has the molecular formula C10H10F2N8O4 and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-amino-9-[(2R,4R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 171931093 |
| Molecular Formula | C10H10F2N8O4 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-amino-9-[(2R,4R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | [N-]=[N+]=NC1(CO)O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)C(F)(F)[C@@H]1O |
| InChI | InChI=1S/C10H10F2N8O4/c11-10(12)6(23)9(1-21,18-19-14)24-7(10)20-2-15-3-4(20)16-8(13)17-5(3)22/h2,6-7,21,23H,1H2,(H3,13,16,17,22)/t6-,7-,9?/m1/s1 |
| InChIKey | GWVOKZKVYLCROD-UMPGHQJDSA-N |
| XLogP | -0.77 |
| TPSA | 188.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|