C10H12FN5O4S — CID 163283558
2-amino-9-[(2R,3R,4R,5R)-3-fluoro-3-hydroxy-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]-1H-purin-6-one (PubChem CID 163283558) has the molecular formula C10H12FN5O4S and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-3-hydroxy-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-3-hydroxy-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 163283558 |
| Molecular Formula | C10H12FN5O4S |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-amino-9-[(2R,3R,4R,5R)-3-fluoro-3-hydroxy-5-(hydroxymethyl)-4-sulfanyloxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@@H](S)[C@]2(O)F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H12FN5O4S/c11-10(19)5(21)3(1-17)20-8(10)16-2-13-4-6(16)14-9(12)15-7(4)18/h2-3,5,8,17,19,21H,1H2,(H3,12,14,15,18)/t3-,5-,8-,10-/m1/s1 |
| InChIKey | KFQRPINHXXFLAK-AEHJODJJSA-N |
| XLogP | -1.45 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|