C16H27N5O5Si — CID 141262048
2-amino-9-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 141262048) has the molecular formula C16H27N5O5Si and a molecular weight of 397.51 g/mol. Its IUPAC name is 2-amino-9-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 141262048 |
| Molecular Formula | C16H27N5O5Si |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-amino-9-[(2R,3S,4R,5R)-3-[tert-butyl(dimethyl)silyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C16H27N5O5Si/c1-15(2,3)27(4,5)16(25)10(23)8(6-22)26-13(16)21-7-18-9-11(21)19-14(17)20-12(9)24/h7-8,10,13,22-23,25H,6H2,1-5H3,(H3,17,19,20,24)/t8-,10-,13-,16+/m1/s1 |
| InChIKey | HKLJJQHUQFPQDC-IEXNBPCCSA-N |
| XLogP | -0.27 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|