C10H13N8O4+ — CID 135788877
[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylimino-iminoazanium (PubChem CID 135788877) has the molecular formula C10H13N8O4+ and a molecular weight of 309.27 g/mol. Its IUPAC name is [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylimino-iminoazanium.
| Compound Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylimino-iminoazanium |
|---|---|
| PubChem CID | 135788877 |
| Molecular Formula | C10H13N8O4+ |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylimino-iminoazanium |
| SMILES | N=[N+]=NCC1OC(n2cnc3c(=O)[nH]c(N)nc32)C(O)C1O |
| InChI | InChI=1S/C10H12N8O4/c11-10-15-7-4(8(21)16-10)13-2-18(7)9-6(20)5(19)3(22-9)1-14-17-12/h2-3,5-6,9,12,19-20H,1H2,(H2-,11,15,16,21)/p+1 |
| InChIKey | VCIIAGTUEUFWIG-UHFFFAOYSA-O |
| XLogP | -2.13 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|