C11H13FN8O3 — CID 91062063
(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-azido-4-(fluoromethyl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 91062063) has the molecular formula C11H13FN8O3 and a molecular weight of 324.28 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-azido-4-(fluoromethyl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-azido-4-(fluoromethyl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 91062063 |
| Molecular Formula | C11H13FN8O3 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-2-azido-4-(fluoromethyl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | [N-]=[N+]=N[C@]1(CO)O[C@@H](n2cnc3c(N)ncnc32)[C@@H](CF)[C@@H]1O |
| InChI | InChI=1S/C11H13FN8O3/c12-1-5-7(22)11(2-21,18-19-14)23-10(5)20-4-17-6-8(13)15-3-16-9(6)20/h3-5,7,10,21-22H,1-2H2,(H2,13,15,16)/t5-,7-,10+,11+/m0/s1 |
| InChIKey | NNAKLHCTFQPXPV-ICERDWBASA-N |
| XLogP | -0.12 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|