C10H11IN8O3 — CID 57038042
(2S,5R)-5-(6-aminopurin-9-yl)-2-azido-2-(iodomethyl)oxolane-3,4-diol (PubChem CID 57038042) has the molecular formula C10H11IN8O3 and a molecular weight of 418.16 g/mol. Its IUPAC name is (2S,5R)-5-(6-aminopurin-9-yl)-2-azido-2-(iodomethyl)oxolane-3,4-diol.
| Compound Name | (2S,5R)-5-(6-aminopurin-9-yl)-2-azido-2-(iodomethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 57038042 |
| Molecular Formula | C10H11IN8O3 |
| Molecular Weight | 418.16 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | (2S,5R)-5-(6-aminopurin-9-yl)-2-azido-2-(iodomethyl)oxolane-3,4-diol |
| SMILES | [N-]=[N+]=N[C@]1(CI)O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C10H11IN8O3/c11-1-10(17-18-13)6(21)5(20)9(22-10)19-3-16-4-7(12)14-2-15-8(4)19/h2-3,5-6,9,20-21H,1H2,(H2,12,14,15)/t5?,6?,9-,10-/m1/s1 |
| InChIKey | SATWANAKCVYMJJ-KAFUYXJBSA-N |
| XLogP | 0.10 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|