C26H28N9O8P — CID 23635147
benzyl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 23635147) has the molecular formula C26H28N9O8P and a molecular weight of 625.54 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 23635147 |
| Molecular Formula | C26H28N9O8P |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-azido-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@@]1(N=[N+]=[N-])O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H28N9O8P/c1-16(25(38)40-12-17-8-4-2-5-9-17)32-44(39,43-18-10-6-3-7-11-18)41-13-26(33-34-28)21(37)20(36)24(42-26)35-15-31-19-22(27)29-14-30-23(19)35/h2-11,14-16,20-21,24,36-37H,12-13H2,1H3,(H,32,39)(H2,27,29,30)/t16-,20+,21-,24+,26+,44?/m0/s1 |
| InChIKey | SNODYHZWQMBPOF-METLZAABSA-N |
| XLogP | 2.59 |
| TPSA | 241.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|