C28H29N6O7P — CID 166551552
benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166551552) has the molecular formula C28H29N6O7P and a molecular weight of 592.55 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166551552 |
| Molecular Formula | C28H29N6O7P |
| Molecular Weight | 592.55 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(N[C@@H](C)C(=O)OCc2ccccc2)Oc2ccccc2)O[C@@H](n2cnc3c(N)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C28H29N6O7P/c1-3-28(22(35)14-23(40-28)34-18-32-24-25(29)30-17-31-26(24)34)16-39-42(37,41-21-12-8-5-9-13-21)33-19(2)27(36)38-15-20-10-6-4-7-11-20/h1,4-13,17-19,22-23,35H,14-16H2,2H3,(H,33,37)(H2,29,30,31)/t19-,22-,23+,28+,42-/m0/s1 |
| InChIKey | QOEOHTWFKFBGKN-JFERSTRGSA-N |
| XLogP | 2.99 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|