C25H30FN6O7P — CID 166551553
propan-2-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate (PubChem CID 166551553) has the molecular formula C25H30FN6O7P and a molecular weight of 576.52 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 166551553 |
| Molecular Formula | C25H30FN6O7P |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-2-methylpropanoate |
| SMILES | C#C[C@]1(CO[P@](=O)(NC(C)(C)C(=O)OC(C)C)Oc2ccccc2)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C25H30FN6O7P/c1-6-25(17(33)12-18(38-25)32-14-28-19-20(27)29-23(26)30-21(19)32)13-36-40(35,39-16-10-8-7-9-11-16)31-24(4,5)22(34)37-15(2)3/h1,7-11,14-15,17-18,33H,12-13H2,2-5H3,(H,31,35)(H2,27,29,30)/t17-,18+,25+,40+/m0/s1 |
| InChIKey | CWANUYRDDOKNNA-DFZSUKJCSA-N |
| XLogP | 2.72 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|