C13H12FN5O5 — CID 169224679
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl hydrogen carbonate (PubChem CID 169224679) has the molecular formula C13H12FN5O5 and a molecular weight of 337.27 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl hydrogen carbonate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 169224679 |
| Molecular Formula | C13H12FN5O5 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl hydrogen carbonate |
| SMILES | C#C[C@]1(COC(=O)O)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C13H12FN5O5/c1-2-13(4-23-12(21)22)6(20)3-7(24-13)19-5-16-8-9(15)17-11(14)18-10(8)19/h1,5-7,20H,3-4H2,(H,21,22)(H2,15,17,18)/t6-,7+,13+/m0/s1 |
| InChIKey | KTIQRVSYYXSCJD-LEAAEXRXSA-N |
| XLogP | -0.11 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|