C30H40FN5O4 — CID 153340385
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 153340385) has the molecular formula C30H40FN5O4 and a molecular weight of 553.68 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 153340385 |
| Molecular Formula | C30H40FN5O4 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | C#C[C@]1(COC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C30H40FN5O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(38)39-21-30(4-2)23(37)20-24(40-30)36-22-33-26-27(32)34-29(31)35-28(26)36/h2,5-6,8-9,11-12,22-24,37H,3,7,10,13-21H2,1H3,(H2,32,34,35)/b6-5-,9-8-,12-11-/t23-,24+,30+/m0/s1 |
| InChIKey | NRTLTGNPBHYEKX-PFIUPZLJSA-N |
| XLogP | 5.33 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|