C13H15FN5O12P3 — CID 167277411
[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-formyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 167277411) has the molecular formula C13H15FN5O12P3 and a molecular weight of 545.21 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-formyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-formyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167277411 |
| Molecular Formula | C13H15FN5O12P3 |
| Molecular Weight | 545.21 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | [[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-formyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1C=O |
| InChI | InChI=1S/C13H15FN5O12P3/c1-2-13(5-28-33(24,25)31-34(26,27)30-32(21,22)23)7(4-20)3-8(29-13)19-6-16-9-10(15)17-12(14)18-11(9)19/h1,4,6-8H,3,5H2,(H,24,25)(H,26,27)(H2,15,17,18)(H2,21,22,23)/t7-,8-,13-/m1/s1 |
| InChIKey | APECGBAXEJULCB-OTPXZMOZSA-N |
| XLogP | -0.00 |
| TPSA | 255.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|