C17H21FN6O4 — CID 165383480
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 165383480) has the molecular formula C17H21FN6O4 and a molecular weight of 392.39 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 165383480 |
| Molecular Formula | C17H21FN6O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C17H21FN6O4/c1-4-17(6-25)9(27-15(26)11(19)8(2)3)5-10(28-17)24-7-21-12-13(20)22-16(18)23-14(12)24/h1,7-11,25H,5-6,19H2,2-3H3,(H2,20,22,23)/t9-,10+,11-,17+/m0/s1 |
| InChIKey | BROLGHBZUBYBDK-VZVWNTEVSA-N |
| XLogP | -0.27 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|