C20H24FN5O5 — CID 155685084
[(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate (PubChem CID 155685084) has the molecular formula C20H24FN5O5 and a molecular weight of 433.44 g/mol. Its IUPAC name is [(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate.
| Compound Name | [(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 155685084 |
| Molecular Formula | C20H24FN5O5 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [(3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate |
| SMILES | C#CC1(COC(=O)CCCC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C20H24FN5O5/c1-4-7-8-15(28)29-10-20(6-3)12(30-14(27)5-2)9-13(31-20)26-11-23-16-17(22)24-19(21)25-18(16)26/h3,11-13H,4-5,7-10H2,1-2H3,(H2,22,24,25)/t12-,13+,20?/m0/s1 |
| InChIKey | NIMVRTRIRUPBGX-OVNXLKRTSA-N |
| XLogP | 1.89 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|