C37H45FN6O5Si — CID 155779400
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] 2-(heptanoylamino)acetate (PubChem CID 155779400) has the molecular formula C37H45FN6O5Si and a molecular weight of 700.89 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] 2-(heptanoylamino)acetate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] 2-(heptanoylamino)acetate |
|---|---|
| PubChem CID | 155779400 |
| Molecular Formula | C37H45FN6O5Si |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl] 2-(heptanoylamino)acetate |
| SMILES | C#C[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)CNC(=O)CCCCCC |
| InChI | InChI=1S/C37H45FN6O5Si/c1-6-8-9-16-21-29(45)40-23-31(46)48-28-22-30(44-25-41-32-33(39)42-35(38)43-34(32)44)49-37(28,7-2)24-47-50(36(3,4)5,26-17-12-10-13-18-26)27-19-14-11-15-20-27/h2,10-15,17-20,25,28,30H,6,8-9,16,21-24H2,1,3-5H3,(H,40,45)(H2,39,42,43)/t28-,30+,37+/m0/s1 |
| InChIKey | SFMFYYVSHVEGSC-RITSTGFBSA-N |
| XLogP | 4.41 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|