C31H34FN5O5Si — CID 163406088
2-[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl]ethyl hydrogen carbonate (PubChem CID 163406088) has the molecular formula C31H34FN5O5Si and a molecular weight of 603.73 g/mol. Its IUPAC name is 2-[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl]ethyl hydrogen carbonate.
| Compound Name | 2-[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 163406088 |
| Molecular Formula | C31H34FN5O5Si |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | 2-[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-ethynyloxolan-3-yl]ethyl hydrogen carbonate |
| SMILES | C#C[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1CCOC(=O)O |
| InChI | InChI=1S/C31H34FN5O5Si/c1-5-31(19-41-43(30(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23)21(16-17-40-29(38)39)18-24(42-31)37-20-34-25-26(33)35-28(32)36-27(25)37/h1,6-15,20-21,24H,16-19H2,2-4H3,(H,38,39)(H2,33,35,36)/t21-,24+,31+/m0/s1 |
| InChIKey | TXCFABXQVVBOCN-CGWIWPGFSA-N |
| XLogP | 4.12 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|