C27H32FN5O2Si — CID 10839282
9-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-yl]-2-fluoropurin-6-amine (PubChem CID 10839282) has the molecular formula C27H32FN5O2Si and a molecular weight of 505.67 g/mol. Its IUPAC name is 9-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-yl]-2-fluoropurin-6-amine.
| Compound Name | 9-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-yl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 10839282 |
| Molecular Formula | C27H32FN5O2Si |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 9-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyloxolan-2-yl]-2-fluoropurin-6-amine |
| SMILES | C[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cnc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C27H32FN5O2Si/c1-18-15-19(35-25(18)33-17-30-22-23(29)31-26(28)32-24(22)33)16-34-36(27(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,17-19,25H,15-16H2,1-4H3,(H2,29,31,32)/t18-,19+,25-/m1/s1 |
| InChIKey | INXHWLMJDJJCBQ-HHJKRLRDSA-N |
| XLogP | 4.05 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|