C27H31N5O7SSi — CID 10722244
9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-6-methoxypurin-2-amine (PubChem CID 10722244) has the molecular formula C27H31N5O7SSi and a molecular weight of 597.73 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-6-methoxypurin-2-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 10722244 |
| Molecular Formula | C27H31N5O7SSi |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OS(=O)(=O)O[C@H]21 |
| InChI | InChI=1S/C27H31N5O7SSi/c1-27(2,3)41(17-11-7-5-8-12-17,18-13-9-6-10-14-18)36-15-19-21-22(39-40(33,34)38-21)25(37-19)32-16-29-20-23(32)30-26(28)31-24(20)35-4/h5-14,16,19,21-22,25H,15H2,1-4H3,(H2,28,30,31)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | YQZKRRRIPSYUCV-PTGPVQHPSA-N |
| XLogP | 1.92 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|