C29H57N5O8Si3 — CID 102050539
9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]peroxy]-5-[[tert-butyl(dimethyl)silyl]peroxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine (PubChem CID 102050539) has the molecular formula C29H57N5O8Si3 and a molecular weight of 688.06 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]peroxy]-5-[[tert-butyl(dimethyl)silyl]peroxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine.
| Compound Name | 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]peroxy]-5-[[tert-butyl(dimethyl)silyl]peroxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 102050539 |
| Molecular Formula | C29H57N5O8Si3 |
| Molecular Weight | 688.06 g/mol |
| Exact Mass | 687.35 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]peroxy]-5-[[tert-butyl(dimethyl)silyl]peroxymethyl]oxolan-2-yl]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COO[Si](C)(C)C(C)(C)C)[C@@H](OO[Si](C)(C)C(C)(C)C)[C@H]1OO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H57N5O8Si3/c1-27(2,3)43(11,12)40-36-17-19-21(38-41-44(13,14)28(4,5)6)22(39-42-45(15,16)29(7,8)9)25(37-19)34-18-31-20-23(34)32-26(30)33-24(20)35-10/h18-19,21-22,25H,17H2,1-16H3,(H2,30,32,33)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | SOMDUWKOBAZBIN-PTGPVQHPSA-N |
| XLogP | 6.91 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.06 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|