C12H17N5O5P+ — CID 123760627
[5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxophosphanium (PubChem CID 123760627) has the molecular formula C12H17N5O5P+ and a molecular weight of 342.27 g/mol. Its IUPAC name is [5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxophosphanium.
| Compound Name | [5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxophosphanium |
|---|---|
| PubChem CID | 123760627 |
| Molecular Formula | C12H17N5O5P+ |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [5-(2-amino-6-methoxypurin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-oxophosphanium |
| SMILES | COc1nc(N)nc2c1ncn2C1OC(CO[PH+]=O)C(O)C1C |
| InChI | InChI=1S/C12H17N5O5P/c1-5-8(18)6(3-21-23-19)22-11(5)17-4-14-7-9(17)15-12(13)16-10(7)20-2/h4-6,8,11,18,23H,3H2,1-2H3,(H2,13,15,16)/q+1 |
| InChIKey | BWQIOMTZPPFUDO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|