C13H19N5O3 — CID 137401300
9-(3-ethoxy-5-methyloxolan-2-yl)-6-methoxypurin-2-amine (PubChem CID 137401300) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 9-(3-ethoxy-5-methyloxolan-2-yl)-6-methoxypurin-2-amine.
| Compound Name | 9-(3-ethoxy-5-methyloxolan-2-yl)-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 137401300 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 9-(3-ethoxy-5-methyloxolan-2-yl)-6-methoxypurin-2-amine |
| SMILES | CCOC1CC(C)OC1n1cnc2c(OC)nc(N)nc21 |
| InChI | InChI=1S/C13H19N5O3/c1-4-20-8-5-7(2)21-12(8)18-6-15-9-10(18)16-13(14)17-11(9)19-3/h6-8,12H,4-5H2,1-3H3,(H2,14,16,17) |
| InChIKey | RZKISODSFBVBMT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |