C28H34N4O9S2Si — CID 135424068
[(2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] methanesulfonate (PubChem CID 135424068) has the molecular formula C28H34N4O9S2Si and a molecular weight of 662.82 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 135424068 |
| Molecular Formula | C28H34N4O9S2Si |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylsulfonyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](OS(C)(=O)=O)[C@@H]1OS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34N4O9S2Si/c1-28(2,3)44(19-12-8-6-9-13-19,20-14-10-7-11-15-20)38-16-21-23(40-42(4,34)35)24(41-43(5,36)37)27(39-21)32-18-31-22-25(32)29-17-30-26(22)33/h6-15,17-18,21,23-24,27H,16H2,1-5H3,(H,29,30,33)/t21-,23-,24-,27-/m1/s1 |
| InChIKey | JMTOTTVUSIADMH-VBHAUSMQSA-N |
| XLogP | 1.28 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|