C29H32N4O3Si — CID 135480219
9-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-1H-purin-6-one (PubChem CID 135480219) has the molecular formula C29H32N4O3Si and a molecular weight of 512.69 g/mol. Its IUPAC name is 9-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135480219 |
| Molecular Formula | C29H32N4O3Si |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 9-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-1H-purin-6-one |
| SMILES | C=CC[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@H](n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C29H32N4O3Si/c1-5-17-29(18-16-24(36-29)33-21-32-25-26(33)30-20-31-27(25)34)19-35-37(28(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h5-16,18,20-21,24H,1,17,19H2,2-4H3,(H,30,31,34)/t24-,29+/m1/s1 |
| InChIKey | BYXVVSJYZGPXRL-GIGWZHCTSA-N |
| XLogP | 4.10 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|