C20H18N4O4 — CID 136694663
[(2R,5R)-2-(6-oxo-1H-purin-9-yl)-5-prop-2-enyl-2H-furan-5-yl]methyl benzoate (PubChem CID 136694663) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is [(2R,5R)-2-(6-oxo-1H-purin-9-yl)-5-prop-2-enyl-2H-furan-5-yl]methyl benzoate.
| Compound Name | [(2R,5R)-2-(6-oxo-1H-purin-9-yl)-5-prop-2-enyl-2H-furan-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 136694663 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(2R,5R)-2-(6-oxo-1H-purin-9-yl)-5-prop-2-enyl-2H-furan-5-yl]methyl benzoate |
| SMILES | C=CC[C@]1(COC(=O)c2ccccc2)C=C[C@H](n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C20H18N4O4/c1-2-9-20(11-27-19(26)14-6-4-3-5-7-14)10-8-15(28-20)24-13-23-16-17(24)21-12-22-18(16)25/h2-8,10,12-13,15H,1,9,11H2,(H,21,22,25)/t15-,20-/m1/s1 |
| InChIKey | SAIRDQRPIZRJKA-FOIQADDNSA-N |
| XLogP | 2.38 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|