C25H20N2O5 — CID 123191528
[5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl 4-phenylbenzoate (PubChem CID 123191528) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is [5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl 4-phenylbenzoate.
| Compound Name | [5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 123191528 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methyl 4-phenylbenzoate |
| SMILES | C#CC1(COC(=O)c2ccc(-c3ccccc3)cc2)C=CC(n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C25H20N2O5/c1-3-25(14-13-21(32-25)27-15-17(2)22(28)26-24(27)30)16-31-23(29)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h1,4-15,21H,16H2,2H3,(H,26,28,30) |
| InChIKey | PMMUQUNHNTUNJI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|