C34H32N3O8P — CID 177261315
benzyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 177261315) has the molecular formula C34H32N3O8P and a molecular weight of 641.62 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 177261315 |
| Molecular Formula | C34H32N3O8P |
| Molecular Weight | 641.62 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,5R)-5-ethynyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | C#C[C@@]1(CO[P@@](=O)(N[C@@H](Cc2ccccc2)C(=O)OCc2ccccc2)Oc2ccccc2)C=C[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C34H32N3O8P/c1-3-34(20-19-30(44-34)37-22-25(2)31(38)35-33(37)40)24-43-46(41,45-28-17-11-6-12-18-28)36-29(21-26-13-7-4-8-14-26)32(39)42-23-27-15-9-5-10-16-27/h1,4-20,22,29-30H,21,23-24H2,2H3,(H,36,41)(H,35,38,40)/t29-,30+,34-,46-/m0/s1 |
| InChIKey | CSWAHAHXDPTULA-QQPJCUMOSA-N |
| XLogP | 4.45 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|