C33H34N3O8P — CID 169257096
benzyl (2S)-2-[[[(2R,5S)-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 169257096) has the molecular formula C33H34N3O8P and a molecular weight of 631.62 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,5S)-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,5S)-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 169257096 |
| Molecular Formula | C33H34N3O8P |
| Molecular Weight | 631.62 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,5S)-5-methyl-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-2H-furan-5-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | Cc1cn([C@H]2C=C[C@@](C)(CO[P@@](=O)(N[C@@H](Cc3ccccc3)C(=O)OCc3ccccc3)Oc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H34N3O8P/c1-24-21-36(32(39)34-30(24)37)29-18-19-33(2,43-29)23-42-45(40,44-27-16-10-5-11-17-27)35-28(20-25-12-6-3-7-13-25)31(38)41-22-26-14-8-4-9-15-26/h3-19,21,28-29H,20,22-23H2,1-2H3,(H,35,40)(H,34,37,39)/t28-,29+,33-,45-/m0/s1 |
| InChIKey | ZEBSGGBHYQDYBC-MQKQBDFKSA-N |
| XLogP | 4.84 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|