C23H30N3O10P — CID 155013533
propan-2-yl 2-[[[(3R,4R,7S)-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 155013533) has the molecular formula C23H30N3O10P and a molecular weight of 539.48 g/mol. Its IUPAC name is propan-2-yl 2-[[[(3R,4R,7S)-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(3R,4R,7S)-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155013533 |
| Molecular Formula | C23H30N3O10P |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | propan-2-yl 2-[[[(3R,4R,7S)-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1cn([C@@H]2OC3(COP(=O)(NC(C)C(=O)OC(C)C)Oc4ccccc4)CO[C@@H]2[C@@H]3O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H30N3O10P/c1-13(2)34-21(29)15(4)25-37(31,36-16-8-6-5-7-9-16)33-12-23-11-32-17(18(23)27)20(35-23)26-10-14(3)19(28)24-22(26)30/h5-10,13,15,17-18,20,27H,11-12H2,1-4H3,(H,25,31)(H,24,28,30)/t15?,17-,18+,20-,23?,37?/m1/s1 |
| InChIKey | ARQIPAJOICGWMF-HMNGCXHBSA-N |
| XLogP | 1.01 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|