C22H30N3O10P — CID 162505141
propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 162505141) has the molecular formula C22H30N3O10P and a molecular weight of 529.48 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 162505141 |
| Molecular Formula | C22H30N3O10P |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | [2H]C([2H])(O[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)[C@@H]1O[C@H](n2cc(C)c(=O)[nH]c2=O)[C@H](O)C1O |
| InChI | InChI=1S/C22H30N3O10P/c1-12(2)33-21(29)14(4)24-36(31,35-15-8-6-5-7-9-15)32-11-16-17(26)18(27)20(34-16)25-10-13(3)19(28)23-22(25)30/h5-10,12,14,16-18,20,26-27H,11H2,1-4H3,(H,24,31)(H,23,28,30)/t14-,16-,17?,18+,20-,36-/m0/s1/i11D2 |
| InChIKey | RAPCDPOKYDTQSM-WTLUMWQMSA-N |
| XLogP | 0.60 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|