C23H29N4O8PS — CID 162505201
propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3-hydroxy-4-isocyano-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 162505201) has the molecular formula C23H29N4O8PS and a molecular weight of 554.56 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3-hydroxy-4-isocyano-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3-hydroxy-4-isocyano-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 162505201 |
| Molecular Formula | C23H29N4O8PS |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | propan-2-yl (2S)-2-[[[dideuterio-[(2S,4R,5S)-3-hydroxy-4-isocyano-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | [2H]C([2H])(O[P@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccccc1)[C@@H]1O[C@H](n2cc(C)c(=O)[nH]c2=S)[C@H]([N+]#[C-])C1O |
| InChI | InChI=1S/C23H29N4O8PS/c1-13(2)33-22(30)15(4)26-36(31,35-16-9-7-6-8-10-16)32-12-17-19(28)18(24-5)21(34-17)27-11-14(3)20(29)25-23(27)37/h6-11,13,15,17-19,21,28H,12H2,1-4H3,(H,26,31)(H,25,29,37)/t15-,17-,18+,19?,21-,36+/m0/s1/i12D2 |
| InChIKey | UDCPHXAKSGOEHG-WKUNNCSQSA-N |
| XLogP | 2.89 |
| TPSA | 145.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|