C22H30N3O9PS — CID 121428047
propan-2-yl (2S)-2-[[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 121428047) has the molecular formula C22H30N3O9PS and a molecular weight of 543.54 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 121428047 |
| Molecular Formula | C22H30N3O9PS |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4R,5S)-3,4-dihydroxy-5-(5-methyl-4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1cn([C@H]2O[C@@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc3ccccc3)C(O)[C@H]2O)c(=S)[nH]c1=O |
| InChI | InChI=1S/C22H30N3O9PS/c1-12(2)32-21(29)14(4)24-35(30,34-15-8-6-5-7-9-15)31-11-16-17(26)18(27)20(33-16)25-10-13(3)19(28)23-22(25)36/h5-10,12,14,16-18,20,26-27H,11H2,1-4H3,(H,24,30)(H,23,28,36)/t14-,16-,17?,18+,20-,35?/m0/s1 |
| InChIKey | CXWFOAZCYXJPHL-BQIJHYSMSA-N |
| XLogP | 1.97 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|