C20H27N4O10P — CID 164541226
propan-2-yl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 164541226) has the molecular formula C20H27N4O10P and a molecular weight of 514.43 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 164541226 |
| Molecular Formula | C20H27N4O10P |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ncc(=O)[nH]c2=O)C(O)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C20H27N4O10P/c1-11(2)32-19(28)12(3)23-35(30,34-13-7-5-4-6-8-13)31-10-14-16(26)17(27)18(33-14)24-20(29)22-15(25)9-21-24/h4-9,11-12,14,16-18,26-27H,10H2,1-3H3,(H,23,30)(H,22,25,29)/t12-,14+,16?,17?,18+,35?/m0/s1 |
| InChIKey | RSEVLDLWEGATHO-NQSRYBAOSA-N |
| XLogP | -0.32 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|