C17H22N5O9P — CID 174229350
2-[[[(2R,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 174229350) has the molecular formula C17H22N5O9P and a molecular weight of 471.36 g/mol. Its IUPAC name is 2-[[[(2R,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(2R,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 174229350 |
| Molecular Formula | C17H22N5O9P |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-[[[(2R,3S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(OC[C@H]1O[C@@H](n2ncc(N)nc2=O)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H22N5O9P/c1-9(16(25)26)21-32(28,31-10-5-3-2-4-6-10)29-8-11-13(23)14(24)15(30-11)22-17(27)20-12(18)7-19-22/h2-7,9,11,13-15,23-24H,8H2,1H3,(H,21,28)(H,25,26)(H2,18,20,27)/t9?,11-,13-,14-,15-,32?/m1/s1 |
| InChIKey | DOTXJPHBAPSRJN-COZJBRIKSA-N |
| XLogP | -0.89 |
| TPSA | 208.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|