C23H31N6O8P — CID 118119330
propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118119330) has the molecular formula C23H31N6O8P and a molecular weight of 550.51 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118119330 |
| Molecular Formula | C23H31N6O8P |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5R)-5-(6-amino-8-methylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc2c(N)ncnc2n1[C@@H]1O[C@H](COP(=O)(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H31N6O8P/c1-12(2)35-23(32)13(3)28-38(33,37-15-8-6-5-7-9-15)34-10-16-18(30)19(31)22(36-16)29-14(4)27-17-20(24)25-11-26-21(17)29/h5-9,11-13,16,18-19,22,30-31H,10H2,1-4H3,(H,28,33)(H2,24,25,26)/t13-,16-,18-,19-,22-,38?/m1/s1 |
| InChIKey | GJWPGCIGXAZDTC-HJOMMEHHSA-N |
| XLogP | 1.47 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|