C23H29ClN5O7P — CID 170125737
propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 170125737) has the molecular formula C23H29ClN5O7P and a molecular weight of 553.94 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 170125737 |
| Molecular Formula | C23H29ClN5O7P |
| Molecular Weight | 553.94 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc2nccnc2n1[C@@H]1O[C@H](CO[P@](=O)(N[C@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@H]1Cl |
| InChI | InChI=1S/C23H29ClN5O7P/c1-13(2)34-23(31)14(3)28-37(32,36-16-8-6-5-7-9-16)33-12-17-19(30)18(24)22(35-17)29-15(4)27-20-21(29)26-11-10-25-20/h5-11,13-14,17-19,22,30H,12H2,1-4H3,(H,28,32)/t14-,17-,18+,19-,22-,37-/m1/s1 |
| InChIKey | OQTJIEBDPWKEHW-JGCARENHSA-N |
| XLogP | 3.13 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.94 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|