C23H28ClFN5O7P — CID 166015753
propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015753) has the molecular formula C23H28ClFN5O7P and a molecular weight of 571.93 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015753 |
| Molecular Formula | C23H28ClFN5O7P |
| Molecular Weight | 571.93 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-3-hydroxy-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc2nccnc2n1[C@@H]1O[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@]1(F)Cl |
| InChI | InChI=1S/C23H28ClFN5O7P/c1-13(2)35-21(32)14(3)29-38(33,37-16-8-6-5-7-9-16)34-12-17-18(31)23(24,25)22(36-17)30-15(4)28-19-20(30)27-11-10-26-19/h5-11,13-14,17-18,22,31H,12H2,1-4H3,(H,29,33)/t14-,17+,18+,22+,23+,38-/m0/s1 |
| InChIKey | HUUUVDYJDKGMLE-CSJGYEOBSA-N |
| XLogP | 3.43 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.93 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|