C24H31FN5O7P — CID 166015809
propan-2-yl 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166015809) has the molecular formula C24H31FN5O7P and a molecular weight of 551.51 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166015809 |
| Molecular Formula | C24H31FN5O7P |
| Molecular Weight | 551.51 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-(2-methylimidazo[4,5-b]pyrazin-3-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1nc2nccnc2n1[C@@H]1O[C@H](CO[P@@](=O)(NC(C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C24H31FN5O7P/c1-14(2)35-22(32)15(3)29-38(33,37-17-9-7-6-8-10-17)34-13-18-19(31)24(5,25)23(36-18)30-16(4)28-20-21(30)27-12-11-26-20/h6-12,14-15,18-19,23,31H,13H2,1-5H3,(H,29,33)/t15?,18-,19-,23-,24-,38+/m1/s1 |
| InChIKey | IYOYCTJXFGOCQF-ILXBEOJPSA-N |
| XLogP | 3.25 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|