C28H39FN7O8P — CID 122527459
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[6-(methylamino)-2-(2-methylpropanoylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 122527459) has the molecular formula C28H39FN7O8P and a molecular weight of 651.63 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[6-(methylamino)-2-(2-methylpropanoylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[6-(methylamino)-2-(2-methylpropanoylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122527459 |
| Molecular Formula | C28H39FN7O8P |
| Molecular Weight | 651.63 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[6-(methylamino)-2-(2-methylpropanoylamino)purin-9-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CNc1nc(NC(=O)C(C)C)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C28H39FN7O8P/c1-15(2)24(38)34-27-32-22(30-7)20-23(33-27)36(14-31-20)26-28(6,29)21(37)19(43-26)13-41-45(40,44-18-11-9-8-10-12-18)35-17(5)25(39)42-16(3)4/h8-12,14-17,19,21,26,37H,13H2,1-7H3,(H,35,40)(H2,30,32,33,34,38)/t17-,19+,21+,26+,28+,45?/m0/s1 |
| InChIKey | IJQYOLWTWUQHGN-WLZHMARCSA-N |
| XLogP | 3.58 |
| TPSA | 188.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|