C23H33N4O10P — CID 164541213
2-ethylbutyl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 164541213) has the molecular formula C23H33N4O10P and a molecular weight of 556.51 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 164541213 |
| Molecular Formula | C23H33N4O10P |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,5R)-5-(3,5-dioxo-1,2,4-triazin-2-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ncc(=O)[nH]c2=O)C(O)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H33N4O10P/c1-4-15(5-2)12-34-22(31)14(3)26-38(33,37-16-9-7-6-8-10-16)35-13-17-19(29)20(30)21(36-17)27-23(32)25-18(28)11-24-27/h6-11,14-15,17,19-21,29-30H,4-5,12-13H2,1-3H3,(H,26,33)(H,25,28,32)/t14-,17+,19?,20?,21+,38?/m0/s1 |
| InChIKey | HDFBLPBHPHIKAT-IKUZRBPFSA-N |
| XLogP | 0.71 |
| TPSA | 191.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|