C26H37N3O9P+ — CID 134557524
2-ethylbutyl (2S)-2-[[[5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 134557524) has the molecular formula C26H37N3O9P+ and a molecular weight of 566.57 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 134557524 |
| Molecular Formula | C26H37N3O9P+ |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OCC1OC([n+]2cccc(C(N)=O)c2)C(O)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H36N3O9P/c1-4-18(5-2)15-35-26(33)17(3)28-39(34,38-20-11-7-6-8-12-20)36-16-21-22(30)23(31)25(37-21)29-13-9-10-19(14-29)24(27)32/h6-14,17-18,21-23,25,30-31H,4-5,15-16H2,1-3H3,(H2-,27,28,32,34)/p+1/t17-,21?,22?,23?,25?,39?/m0/s1 |
| InChIKey | IEECJYONBFBGAT-TUOSYYAXSA-O |
| XLogP | 1.85 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|