C29H39N3O9P+ — CID 129125645
cyclohexyl (2S)-2-[[[(3aS,4R,6R)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 129125645) has the molecular formula C29H39N3O9P+ and a molecular weight of 604.62 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[[(3aS,4R,6R)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[[(3aS,4R,6R)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129125645 |
| Molecular Formula | C29H39N3O9P+ |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | cyclohexyl (2S)-2-[[[(3aS,4R,6R)-4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H]2OC(C)(C)OC12)Oc1ccccc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C29H38N3O9P/c1-19(28(34)37-21-12-6-4-7-13-21)31-42(35,41-22-14-8-5-9-15-22)36-18-23-24-25(40-29(2,3)39-24)27(38-23)32-16-10-11-20(17-32)26(30)33/h5,8-11,14-17,19,21,23-25,27H,4,6-7,12-13,18H2,1-3H3,(H2-,30,31,33,35)/p+1/t19-,23+,24?,25-,27+,42?/m0/s1 |
| InChIKey | URKKVGVVKVRYBW-DMLJQDHGSA-O |
| XLogP | 3.55 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|