C25H35N3O9P+ — CID 126555051
2,2-dimethylpropyl 2-[[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126555051) has the molecular formula C25H35N3O9P+ and a molecular weight of 552.54 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl 2-[[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126555051 |
| Molecular Formula | C25H35N3O9P+ |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 2,2-dimethylpropyl 2-[[[(3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(OCC1O[C@@H]([n+]2cccc(C(N)=O)c2)[C@H](O)[C@@H]1O)Oc1ccccc1)C(=O)OCC(C)(C)C |
| InChI | InChI=1S/C25H34N3O9P/c1-16(24(32)34-15-25(2,3)4)27-38(33,37-18-10-6-5-7-11-18)35-14-19-20(29)21(30)23(36-19)28-12-8-9-17(13-28)22(26)31/h5-13,16,19-21,23,29-30H,14-15H2,1-4H3,(H2-,26,27,31,33)/p+1/t16?,19?,20-,21-,23-,38?/m1/s1 |
| InChIKey | CTRXDIZAXINUIN-CLXPIDEJSA-O |
| XLogP | 1.46 |
| TPSA | 170.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|